About 3-(2,3-dihydroxypropyldisulfanyl)propane-1,2-diol
3-(2,3-dihydroxypropyldisulfanyl)propane-1,2-diol (PubChem CID 10846312) has the molecular formula C6H14O4S2
and a molecular weight of 214.31 g/mol. Its IUPAC name is 3-(2,3-dihydroxypropyldisulfanyl)propane-1,2-diol.
Molecular Properties
| Compound Name | 3-(2,3-dihydroxypropyldisulfanyl)propane-1,2-diol |
| PubChem CID | 10846312 |
| Molecular Formula | C6H14O4S2 |
| Molecular Weight | 214.31 g/mol |
| Exact Mass | 214.03 |
| IUPAC Name | 3-(2,3-dihydroxypropyldisulfanyl)propane-1,2-diol |
| SMILES | OCC(O)CSSCC(O)CO |
| InChI | InChI=1S/C6H14O4S2/c7-1-5(9)3-11-12-4-6(10)2-8/h5-10H,1-4H2 |
| InChIKey | KEPSVHAYVNZDDW-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 80.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.31 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|
Analyze 3-(2,3-dihydroxypropyldisulfanyl)propane-1,2-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,3-dihydroxypropyldisulfanyl)propane-1,2-diol?
The IUPAC name of 3-(2,3-dihydroxypropyldisulfanyl)propane-1,2-diol (CID 10846312) is 3-(2,3-dihydroxypropyldisulfanyl)propane-1,2-diol.
What is the SMILES notation for 3-(2,3-dihydroxypropyldisulfanyl)propane-1,2-diol?
The canonical SMILES for 3-(2,3-dihydroxypropyldisulfanyl)propane-1,2-diol is OCC(O)CSSCC(O)CO.
What is the InChIKey of 3-(2,3-dihydroxypropyldisulfanyl)propane-1,2-diol?
The InChIKey is KEPSVHAYVNZDDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14O4S2/c7-1-5(9)3-11-12-4-6(10)2-8/h5-10H,1-4H2.
What are the key properties of 3-(2,3-dihydroxypropyldisulfanyl)propane-1,2-diol?
3-(2,3-dihydroxypropyldisulfanyl)propane-1,2-diol has a molecular weight of 214.31 g/mol, XLogP of -0.93, 7 rotatable bonds, 4 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,3-dihydroxypropyldisulfanyl)propane-1,2-diol is sourced from PubChem (CID 10846312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).