C10H18O3Si — CID 10846321
(3aS,6R,6aR)-6-trimethylsilyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one (PubChem CID 10846321) has the molecular formula C10H18O3Si and a molecular weight of 214.34 g/mol. Its IUPAC name is (3aS,6R,6aR)-6-trimethylsilyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one.
| Compound Name | (3aS,6R,6aR)-6-trimethylsilyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
|---|---|
| PubChem CID | 10846321 |
| Molecular Formula | C10H18O3Si |
| Molecular Weight | 214.34 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | (3aS,6R,6aR)-6-trimethylsilyloxy-3,3a,4,5,6,6a-hexahydrocyclopenta[b]furan-2-one |
| SMILES | C[Si](C)(C)O[C@@H]1CC[C@H]2CC(=O)O[C@H]21 |
| InChI | InChI=1S/C10H18O3Si/c1-14(2,3)13-8-5-4-7-6-9(11)12-10(7)8/h7-8,10H,4-6H2,1-3H3/t7-,8+,10+/m0/s1 |
| InChIKey | IKCIZUYGAWSAMG-QXFUBDJGSA-N |
| XLogP | 1.93 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.34 |
| LogP ≤ 5 | 1.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|