C12H17NO3 — CID 10846731
(2S)-N,2-dimethoxy-N-methyl-3-phenylpropanamide (PubChem CID 10846731) has the molecular formula C12H17NO3 and a molecular weight of 223.27 g/mol. Its IUPAC name is (2S)-N,2-dimethoxy-N-methyl-3-phenylpropanamide.
| Compound Name | (2S)-N,2-dimethoxy-N-methyl-3-phenylpropanamide |
|---|---|
| PubChem CID | 10846731 |
| Molecular Formula | C12H17NO3 |
| Molecular Weight | 223.27 g/mol |
| Exact Mass | 223.12 |
| IUPAC Name | (2S)-N,2-dimethoxy-N-methyl-3-phenylpropanamide |
| SMILES | CO[C@@H](Cc1ccccc1)C(=O)N(C)OC |
| InChI | InChI=1S/C12H17NO3/c1-13(16-3)12(14)11(15-2)9-10-7-5-4-6-8-10/h4-8,11H,9H2,1-3H3/t11-/m0/s1 |
| InChIKey | DFOHHZAZWIGGJL-NSHDSACASA-N |
| XLogP | 1.26 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.27 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|