C10H12N2S2 — CID 10846791
5,10-dimethyl-3,12-dithia-6,9-diazatricyclo[7.3.0.02,6]dodeca-1,4,10-triene (PubChem CID 10846791) has the molecular formula C10H12N2S2 and a molecular weight of 224.35 g/mol. Its IUPAC name is 5,10-dimethyl-3,12-dithia-6,9-diazatricyclo[7.3.0.02,6]dodeca-1,4,10-triene.
| Compound Name | 5,10-dimethyl-3,12-dithia-6,9-diazatricyclo[7.3.0.02,6]dodeca-1,4,10-triene |
|---|---|
| PubChem CID | 10846791 |
| Molecular Formula | C10H12N2S2 |
| Molecular Weight | 224.35 g/mol |
| Exact Mass | 224.04 |
| IUPAC Name | 5,10-dimethyl-3,12-dithia-6,9-diazatricyclo[7.3.0.02,6]dodeca-1,4,10-triene |
| SMILES | CC1=CSC2=C3SC=C(C)N3CCN12 |
| InChI | InChI=1S/C10H12N2S2/c1-7-5-13-9-10-12(4-3-11(7)9)8(2)6-14-10/h5-6H,3-4H2,1-2H3 |
| InChIKey | LFWHFMPIMTUZPZ-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.35 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |