About ethyl 3-(dimethylaminodiazenyl)-5-methyl-1,2-oxazole-4-carboxylate
ethyl 3-(dimethylaminodiazenyl)-5-methyl-1,2-oxazole-4-carboxylate (PubChem CID 10846855) has the molecular formula C9H14N4O3
and a molecular weight of 226.24 g/mol. Its IUPAC name is ethyl 3-(dimethylaminodiazenyl)-5-methyl-1,2-oxazole-4-carboxylate.
Molecular Properties
| Compound Name | ethyl 3-(dimethylaminodiazenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| PubChem CID | 10846855 |
| Molecular Formula | C9H14N4O3 |
| Molecular Weight | 226.24 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | ethyl 3-(dimethylaminodiazenyl)-5-methyl-1,2-oxazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(/N=N/N(C)C)noc1C |
| InChI | InChI=1S/C9H14N4O3/c1-5-15-9(14)7-6(2)16-11-8(7)10-12-13(3)4/h5H2,1-4H3/b12-10+ |
| InChIKey | BHBBLEMBNNUBCC-ZRDIBKRKSA-N |
| XLogP | 1.72 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.24 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-(dimethylaminodiazenyl)-5-methyl-1,2-oxazole-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(dimethylaminodiazenyl)-5-methyl-1,2-oxazole-4-carboxylate?
The IUPAC name of ethyl 3-(dimethylaminodiazenyl)-5-methyl-1,2-oxazole-4-carboxylate (CID 10846855) is ethyl 3-(dimethylaminodiazenyl)-5-methyl-1,2-oxazole-4-carboxylate.
What is the SMILES notation for ethyl 3-(dimethylaminodiazenyl)-5-methyl-1,2-oxazole-4-carboxylate?
The canonical SMILES for ethyl 3-(dimethylaminodiazenyl)-5-methyl-1,2-oxazole-4-carboxylate is CCOC(=O)c1c(/N=N/N(C)C)noc1C.
What is the InChIKey of ethyl 3-(dimethylaminodiazenyl)-5-methyl-1,2-oxazole-4-carboxylate?
The InChIKey is BHBBLEMBNNUBCC-ZRDIBKRKSA-N. The full InChI is InChI=1S/C9H14N4O3/c1-5-15-9(14)7-6(2)16-11-8(7)10-12-13(3)4/h5H2,1-4H3/b12-10+.
What are the key properties of ethyl 3-(dimethylaminodiazenyl)-5-methyl-1,2-oxazole-4-carboxylate?
ethyl 3-(dimethylaminodiazenyl)-5-methyl-1,2-oxazole-4-carboxylate has a molecular weight of 226.24 g/mol, XLogP of 1.72, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(dimethylaminodiazenyl)-5-methyl-1,2-oxazole-4-carboxylate is sourced from PubChem (CID 10846855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).