About 2-ethynylpyrene
2-ethynylpyrene (PubChem CID 10846871) has the molecular formula C18H10
and a molecular weight of 226.28 g/mol. Its IUPAC name is 2-ethynylpyrene.
Molecular Properties
| Compound Name | 2-ethynylpyrene |
| PubChem CID | 10846871 |
| Molecular Formula | C18H10 |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | 2-ethynylpyrene |
| SMILES | C#Cc1cc2ccc3cccc4ccc(c1)c2c34 |
| InChI | InChI=1S/C18H10/c1-2-12-10-15-8-6-13-4-3-5-14-7-9-16(11-12)18(15)17(13)14/h1,3-11H |
| InChIKey | VVMDWPNNECNGTO-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-ethynylpyrene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethynylpyrene?
The IUPAC name of 2-ethynylpyrene (CID 10846871) is 2-ethynylpyrene.
What is the SMILES notation for 2-ethynylpyrene?
The canonical SMILES for 2-ethynylpyrene is C#Cc1cc2ccc3cccc4ccc(c1)c2c34.
What is the InChIKey of 2-ethynylpyrene?
The InChIKey is VVMDWPNNECNGTO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H10/c1-2-12-10-15-8-6-13-4-3-5-14-7-9-16(11-12)18(15)17(13)14/h1,3-11H.
What are the key properties of 2-ethynylpyrene?
2-ethynylpyrene has a molecular weight of 226.28 g/mol, XLogP of 4.57, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethynylpyrene is sourced from PubChem (CID 10846871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).