About (2R)-2-[2-[(2R,3S)-3-hydroxyoxan-2-yl]ethyl]oxan-3-one
(2R)-2-[2-[(2R,3S)-3-hydroxyoxan-2-yl]ethyl]oxan-3-one (PubChem CID 10846957) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is (2R)-2-[2-[(2R,3S)-3-hydroxyoxan-2-yl]ethyl]oxan-3-one.
Molecular Properties
| Compound Name | (2R)-2-[2-[(2R,3S)-3-hydroxyoxan-2-yl]ethyl]oxan-3-one |
| PubChem CID | 10846957 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | (2R)-2-[2-[(2R,3S)-3-hydroxyoxan-2-yl]ethyl]oxan-3-one |
| SMILES | O=C1CCCO[C@@H]1CC[C@H]1OCCC[C@@H]1O |
| InChI | InChI=1S/C12H20O4/c13-9-3-1-7-15-11(9)5-6-12-10(14)4-2-8-16-12/h9,11-13H,1-8H2/t9-,11+,12+/m0/s1 |
| InChIKey | IBBUMFUZTIVCEW-MVWJERBFSA-N |
| XLogP | 1.05 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze (2R)-2-[2-[(2R,3S)-3-hydroxyoxan-2-yl]ethyl]oxan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[2-[(2R,3S)-3-hydroxyoxan-2-yl]ethyl]oxan-3-one?
The IUPAC name of (2R)-2-[2-[(2R,3S)-3-hydroxyoxan-2-yl]ethyl]oxan-3-one (CID 10846957) is (2R)-2-[2-[(2R,3S)-3-hydroxyoxan-2-yl]ethyl]oxan-3-one.
What is the SMILES notation for (2R)-2-[2-[(2R,3S)-3-hydroxyoxan-2-yl]ethyl]oxan-3-one?
The canonical SMILES for (2R)-2-[2-[(2R,3S)-3-hydroxyoxan-2-yl]ethyl]oxan-3-one is O=C1CCCO[C@@H]1CC[C@H]1OCCC[C@@H]1O.
What is the InChIKey of (2R)-2-[2-[(2R,3S)-3-hydroxyoxan-2-yl]ethyl]oxan-3-one?
The InChIKey is IBBUMFUZTIVCEW-MVWJERBFSA-N. The full InChI is InChI=1S/C12H20O4/c13-9-3-1-7-15-11(9)5-6-12-10(14)4-2-8-16-12/h9,11-13H,1-8H2/t9-,11+,12+/m0/s1.
What are the key properties of (2R)-2-[2-[(2R,3S)-3-hydroxyoxan-2-yl]ethyl]oxan-3-one?
(2R)-2-[2-[(2R,3S)-3-hydroxyoxan-2-yl]ethyl]oxan-3-one has a molecular weight of 228.29 g/mol, XLogP of 1.05, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[2-[(2R,3S)-3-hydroxyoxan-2-yl]ethyl]oxan-3-one is sourced from PubChem (CID 10846957), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).