About 4-[(2R,4S,5E)-5-(2-hydroxyethylidene)-2-methoxyoxan-4-yl]butan-2-one
4-[(2R,4S,5E)-5-(2-hydroxyethylidene)-2-methoxyoxan-4-yl]butan-2-one (PubChem CID 10846962) has the molecular formula C12H20O4
and a molecular weight of 228.29 g/mol. Its IUPAC name is 4-[(2R,4S,5E)-5-(2-hydroxyethylidene)-2-methoxyoxan-4-yl]butan-2-one.
Molecular Properties
| Compound Name | 4-[(2R,4S,5E)-5-(2-hydroxyethylidene)-2-methoxyoxan-4-yl]butan-2-one |
| PubChem CID | 10846962 |
| Molecular Formula | C12H20O4 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.14 |
| IUPAC Name | 4-[(2R,4S,5E)-5-(2-hydroxyethylidene)-2-methoxyoxan-4-yl]butan-2-one |
| SMILES | CO[C@H]1C[C@H](CCC(C)=O)/C(=C\CO)CO1 |
| InChI | InChI=1S/C12H20O4/c1-9(14)3-4-10-7-12(15-2)16-8-11(10)5-6-13/h5,10,12-13H,3-4,6-8H2,1-2H3/b11-5-/t10-,12+/m0/s1 |
| InChIKey | MNLPKAXLIKEMBI-YFVZMKLFSA-N |
| XLogP | 1.28 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 4-[(2R,4S,5E)-5-(2-hydroxyethylidene)-2-methoxyoxan-4-yl]butan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(2R,4S,5E)-5-(2-hydroxyethylidene)-2-methoxyoxan-4-yl]butan-2-one?
The IUPAC name of 4-[(2R,4S,5E)-5-(2-hydroxyethylidene)-2-methoxyoxan-4-yl]butan-2-one (CID 10846962) is 4-[(2R,4S,5E)-5-(2-hydroxyethylidene)-2-methoxyoxan-4-yl]butan-2-one.
What is the SMILES notation for 4-[(2R,4S,5E)-5-(2-hydroxyethylidene)-2-methoxyoxan-4-yl]butan-2-one?
The canonical SMILES for 4-[(2R,4S,5E)-5-(2-hydroxyethylidene)-2-methoxyoxan-4-yl]butan-2-one is CO[C@H]1C[C@H](CCC(C)=O)/C(=C\CO)CO1.
What is the InChIKey of 4-[(2R,4S,5E)-5-(2-hydroxyethylidene)-2-methoxyoxan-4-yl]butan-2-one?
The InChIKey is MNLPKAXLIKEMBI-YFVZMKLFSA-N. The full InChI is InChI=1S/C12H20O4/c1-9(14)3-4-10-7-12(15-2)16-8-11(10)5-6-13/h5,10,12-13H,3-4,6-8H2,1-2H3/b11-5-/t10-,12+/m0/s1.
What are the key properties of 4-[(2R,4S,5E)-5-(2-hydroxyethylidene)-2-methoxyoxan-4-yl]butan-2-one?
4-[(2R,4S,5E)-5-(2-hydroxyethylidene)-2-methoxyoxan-4-yl]butan-2-one has a molecular weight of 228.29 g/mol, XLogP of 1.28, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(2R,4S,5E)-5-(2-hydroxyethylidene)-2-methoxyoxan-4-yl]butan-2-one is sourced from PubChem (CID 10846962), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).