About tert-butyl 2,5,5-trimethylpiperazine-1-carboxylate
tert-butyl 2,5,5-trimethylpiperazine-1-carboxylate (PubChem CID 10846978) has the molecular formula C12H24N2O2
and a molecular weight of 228.34 g/mol. Its IUPAC name is tert-butyl 2,5,5-trimethylpiperazine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 2,5,5-trimethylpiperazine-1-carboxylate |
| PubChem CID | 10846978 |
| Molecular Formula | C12H24N2O2 |
| Molecular Weight | 228.34 g/mol |
| Exact Mass | 228.18 |
| IUPAC Name | tert-butyl 2,5,5-trimethylpiperazine-1-carboxylate |
| SMILES | CC1CNC(C)(C)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C12H24N2O2/c1-9-7-13-12(5,6)8-14(9)10(15)16-11(2,3)4/h9,13H,7-8H2,1-6H3 |
| InChIKey | RFKDQNITCIOVID-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.34 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 2,5,5-trimethylpiperazine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 2,5,5-trimethylpiperazine-1-carboxylate?
The IUPAC name of tert-butyl 2,5,5-trimethylpiperazine-1-carboxylate (CID 10846978) is tert-butyl 2,5,5-trimethylpiperazine-1-carboxylate.
What is the SMILES notation for tert-butyl 2,5,5-trimethylpiperazine-1-carboxylate?
The canonical SMILES for tert-butyl 2,5,5-trimethylpiperazine-1-carboxylate is CC1CNC(C)(C)CN1C(=O)OC(C)(C)C.
What is the InChIKey of tert-butyl 2,5,5-trimethylpiperazine-1-carboxylate?
The InChIKey is RFKDQNITCIOVID-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24N2O2/c1-9-7-13-12(5,6)8-14(9)10(15)16-11(2,3)4/h9,13H,7-8H2,1-6H3.
What are the key properties of tert-butyl 2,5,5-trimethylpiperazine-1-carboxylate?
tert-butyl 2,5,5-trimethylpiperazine-1-carboxylate has a molecular weight of 228.34 g/mol, XLogP of 1.99, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 2,5,5-trimethylpiperazine-1-carboxylate is sourced from PubChem (CID 10846978), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).