About N'-[[(2R,4S)-4-(3-aminopropylamino)pyrrolidin-2-yl]methyl]propane-1,3-diamine
N'-[[(2R,4S)-4-(3-aminopropylamino)pyrrolidin-2-yl]methyl]propane-1,3-diamine (PubChem CID 10847025) has the molecular formula C11H27N5
and a molecular weight of 229.37 g/mol. Its IUPAC name is N'-[[(2R,4S)-4-(3-aminopropylamino)pyrrolidin-2-yl]methyl]propane-1,3-diamine.
Molecular Properties
| Compound Name | N'-[[(2R,4S)-4-(3-aminopropylamino)pyrrolidin-2-yl]methyl]propane-1,3-diamine |
| PubChem CID | 10847025 |
| Molecular Formula | C11H27N5 |
| Molecular Weight | 229.37 g/mol |
| Exact Mass | 229.23 |
| IUPAC Name | N'-[[(2R,4S)-4-(3-aminopropylamino)pyrrolidin-2-yl]methyl]propane-1,3-diamine |
| SMILES | NCCCNC[C@H]1C[C@H](NCCCN)CN1 |
| InChI | InChI=1S/C11H27N5/c12-3-1-5-14-8-10-7-11(9-16-10)15-6-2-4-13/h10-11,14-16H,1-9,12-13H2/t10-,11+/m1/s1 |
| InChIKey | UOTKFYUYKWQBMT-MNOVXSKESA-N |
| XLogP | -1.41 |
| TPSA | 88.13 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 229.37 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N'-[[(2R,4S)-4-(3-aminopropylamino)pyrrolidin-2-yl]methyl]propane-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-[[(2R,4S)-4-(3-aminopropylamino)pyrrolidin-2-yl]methyl]propane-1,3-diamine?
The IUPAC name of N'-[[(2R,4S)-4-(3-aminopropylamino)pyrrolidin-2-yl]methyl]propane-1,3-diamine (CID 10847025) is N'-[[(2R,4S)-4-(3-aminopropylamino)pyrrolidin-2-yl]methyl]propane-1,3-diamine.
What is the SMILES notation for N'-[[(2R,4S)-4-(3-aminopropylamino)pyrrolidin-2-yl]methyl]propane-1,3-diamine?
The canonical SMILES for N'-[[(2R,4S)-4-(3-aminopropylamino)pyrrolidin-2-yl]methyl]propane-1,3-diamine is NCCCNC[C@H]1C[C@H](NCCCN)CN1.
What is the InChIKey of N'-[[(2R,4S)-4-(3-aminopropylamino)pyrrolidin-2-yl]methyl]propane-1,3-diamine?
The InChIKey is UOTKFYUYKWQBMT-MNOVXSKESA-N. The full InChI is InChI=1S/C11H27N5/c12-3-1-5-14-8-10-7-11(9-16-10)15-6-2-4-13/h10-11,14-16H,1-9,12-13H2/t10-,11+/m1/s1.
What are the key properties of N'-[[(2R,4S)-4-(3-aminopropylamino)pyrrolidin-2-yl]methyl]propane-1,3-diamine?
N'-[[(2R,4S)-4-(3-aminopropylamino)pyrrolidin-2-yl]methyl]propane-1,3-diamine has a molecular weight of 229.37 g/mol, XLogP of -1.41, 9 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-[[(2R,4S)-4-(3-aminopropylamino)pyrrolidin-2-yl]methyl]propane-1,3-diamine is sourced from PubChem (CID 10847025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).