C8H13F5Si — CID 10847162
trimethyl(3,3,4,5,5-pentafluoropent-4-enyl)silane (PubChem CID 10847162) has the molecular formula C8H13F5Si and a molecular weight of 232.27 g/mol. Its IUPAC name is trimethyl(3,3,4,5,5-pentafluoropent-4-enyl)silane.
| Compound Name | trimethyl(3,3,4,5,5-pentafluoropent-4-enyl)silane |
|---|---|
| PubChem CID | 10847162 |
| Molecular Formula | C8H13F5Si |
| Molecular Weight | 232.27 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | trimethyl(3,3,4,5,5-pentafluoropent-4-enyl)silane |
| SMILES | C[Si](C)(C)CCC(F)(F)C(F)=C(F)F |
| InChI | InChI=1S/C8H13F5Si/c1-14(2,3)5-4-8(12,13)6(9)7(10)11/h4-5H2,1-3H3 |
| InChIKey | GKKCYYQAGDHPTR-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.27 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|