C14H16O3 — CID 10847168
(2E,4R,5R)-2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]decan-4-ol (PubChem CID 10847168) has the molecular formula C14H16O3 and a molecular weight of 232.28 g/mol. Its IUPAC name is (2E,4R,5R)-2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]decan-4-ol.
| Compound Name | (2E,4R,5R)-2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]decan-4-ol |
|---|---|
| PubChem CID | 10847168 |
| Molecular Formula | C14H16O3 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.11 |
| IUPAC Name | (2E,4R,5R)-2-hexa-2,4-diynylidene-1,10-dioxaspiro[4.5]decan-4-ol |
| SMILES | CC#CC#C/C=C1\C[C@@H](O)[C@@]2(CCCCO2)O1 |
| InChI | InChI=1S/C14H16O3/c1-2-3-4-5-8-12-11-13(15)14(17-12)9-6-7-10-16-14/h8,13,15H,6-7,9-11H2,1H3/b12-8+/t13-,14-/m1/s1 |
| InChIKey | NOOKWDVEEHAOTC-DXIMFJFMSA-N |
| XLogP | 1.58 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|