About (E)-1-diethoxyphosphoryl-2,3,3-trimethylbut-1-ene
(E)-1-diethoxyphosphoryl-2,3,3-trimethylbut-1-ene (PubChem CID 10847290) has the molecular formula C11H23O3P
and a molecular weight of 234.28 g/mol. Its IUPAC name is (E)-1-diethoxyphosphoryl-2,3,3-trimethylbut-1-ene.
Molecular Properties
| Compound Name | (E)-1-diethoxyphosphoryl-2,3,3-trimethylbut-1-ene |
| PubChem CID | 10847290 |
| Molecular Formula | C11H23O3P |
| Molecular Weight | 234.28 g/mol |
| Exact Mass | 234.14 |
| IUPAC Name | (E)-1-diethoxyphosphoryl-2,3,3-trimethylbut-1-ene |
| SMILES | CCOP(=O)(/C=C(\C)C(C)(C)C)OCC |
| InChI | InChI=1S/C11H23O3P/c1-7-13-15(12,14-8-2)9-10(3)11(4,5)6/h9H,7-8H2,1-6H3/b10-9+ |
| InChIKey | KKTLUHZHPJOIQG-MDZDMXLPSA-N |
| XLogP | 4.20 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.28 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze (E)-1-diethoxyphosphoryl-2,3,3-trimethylbut-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-1-diethoxyphosphoryl-2,3,3-trimethylbut-1-ene?
The IUPAC name of (E)-1-diethoxyphosphoryl-2,3,3-trimethylbut-1-ene (CID 10847290) is (E)-1-diethoxyphosphoryl-2,3,3-trimethylbut-1-ene.
What is the SMILES notation for (E)-1-diethoxyphosphoryl-2,3,3-trimethylbut-1-ene?
The canonical SMILES for (E)-1-diethoxyphosphoryl-2,3,3-trimethylbut-1-ene is CCOP(=O)(/C=C(\C)C(C)(C)C)OCC.
What is the InChIKey of (E)-1-diethoxyphosphoryl-2,3,3-trimethylbut-1-ene?
The InChIKey is KKTLUHZHPJOIQG-MDZDMXLPSA-N. The full InChI is InChI=1S/C11H23O3P/c1-7-13-15(12,14-8-2)9-10(3)11(4,5)6/h9H,7-8H2,1-6H3/b10-9+.
What are the key properties of (E)-1-diethoxyphosphoryl-2,3,3-trimethylbut-1-ene?
(E)-1-diethoxyphosphoryl-2,3,3-trimethylbut-1-ene has a molecular weight of 234.28 g/mol, XLogP of 4.20, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-1-diethoxyphosphoryl-2,3,3-trimethylbut-1-ene is sourced from PubChem (CID 10847290), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).