C15H22O2 — CID 10847314
(3aS,7aR)-7-(cyclohexen-1-yl)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole (PubChem CID 10847314) has the molecular formula C15H22O2 and a molecular weight of 234.34 g/mol. Its IUPAC name is (3aS,7aR)-7-(cyclohexen-1-yl)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole.
| Compound Name | (3aS,7aR)-7-(cyclohexen-1-yl)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole |
|---|---|
| PubChem CID | 10847314 |
| Molecular Formula | C15H22O2 |
| Molecular Weight | 234.34 g/mol |
| Exact Mass | 234.16 |
| IUPAC Name | (3aS,7aR)-7-(cyclohexen-1-yl)-2,2-dimethyl-3a,4,5,7a-tetrahydro-1,3-benzodioxole |
| SMILES | CC1(C)O[C@H]2CCC=C(C3=CCCCC3)[C@H]2O1 |
| InChI | InChI=1S/C15H22O2/c1-15(2)16-13-10-6-9-12(14(13)17-15)11-7-4-3-5-8-11/h7,9,13-14H,3-6,8,10H2,1-2H3/t13-,14+/m0/s1 |
| InChIKey | PIZGLAPGILNXKW-UONOGXRCSA-N |
| XLogP | 3.73 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.34 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |