C14H18FNO — CID 10847358
(4aR,8aS)-2-(4-fluorophenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazine (PubChem CID 10847358) has the molecular formula C14H18FNO and a molecular weight of 235.30 g/mol. Its IUPAC name is (4aR,8aS)-2-(4-fluorophenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (4aR,8aS)-2-(4-fluorophenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 10847358 |
| Molecular Formula | C14H18FNO |
| Molecular Weight | 235.30 g/mol |
| Exact Mass | 235.14 |
| IUPAC Name | (4aR,8aS)-2-(4-fluorophenyl)-3,4,4a,5,6,7,8,8a-octahydro-2H-benzo[e][1,3]oxazine |
| SMILES | Fc1ccc(C2NC[C@H]3CCCC[C@@H]3O2)cc1 |
| InChI | InChI=1S/C14H18FNO/c15-12-7-5-10(6-8-12)14-16-9-11-3-1-2-4-13(11)17-14/h5-8,11,13-14,16H,1-4,9H2/t11-,13+,14?/m1/s1 |
| InChIKey | OKFAUDCEDOUTDE-LXKBMQFRSA-N |
| XLogP | 3.00 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.30 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |