C15H24O2 — CID 10847444
cis-(2S,5R)-2-methyl-2-(4-oxopentyl)-5-prop-1-en-2-ylcyclohexan-1-one (PubChem CID 10847444) has the molecular formula C15H24O2 and a molecular weight of 236.35 g/mol. Its IUPAC name is cis-(2S,5R)-2-methyl-2-(4-oxopentyl)-5-prop-1-en-2-ylcyclohexan-1-one.
| Compound Name | cis-(2S,5R)-2-methyl-2-(4-oxopentyl)-5-prop-1-en-2-ylcyclohexan-1-one |
|---|---|
| PubChem CID | 10847444 |
| Molecular Formula | C15H24O2 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 236.18 |
| IUPAC Name | cis-(2S,5R)-2-methyl-2-(4-oxopentyl)-5-prop-1-en-2-ylcyclohexan-1-one |
| SMILES | C=C(C)[C@@H]1CC[C@](C)(CCCC(C)=O)C(=O)C1 |
| InChI | InChI=1S/C15H24O2/c1-11(2)13-7-9-15(4,14(17)10-13)8-5-6-12(3)16/h13H,1,5-10H2,2-4H3/t13-,15+/m1/s1 |
| InChIKey | FCPUGTGXHMJFQH-HIFRSBDPSA-N |
| XLogP | 3.70 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|