2-(4-oxo-2-phenyl-1,3-thiazolidin-3-yl)acetic acid

C11H11NO3S — CID 10847476

IUPAC2-(4-oxo-2-phenyl-1,3-thiazolidin-3-yl)acetic acid
SMILESO=C(O)CN1C(=O)CSC1c1ccccc1
InChIInChI=1S/C11H11NO3S/c13-9-7-16-11(12(9)6-10(14)15)8-4-2-1-3-5-8/h1-5,11H,6-7H2,(H,14,15)
InChIKeyRACZCUSQYCSZAE-UHFFFAOYSA-N
MW237.28 g/mol
LogP1.35
Rot. Bonds3

About 2-(4-oxo-2-phenyl-1,3-thiazolidin-3-yl)acetic acid

2-(4-oxo-2-phenyl-1,3-thiazolidin-3-yl)acetic acid (PubChem CID 10847476) has the molecular formula C11H11NO3S and a molecular weight of 237.28 g/mol. Its IUPAC name is 2-(4-oxo-2-phenyl-1,3-thiazolidin-3-yl)acetic acid.

Molecular Properties

Compound Name2-(4-oxo-2-phenyl-1,3-thiazolidin-3-yl)acetic acid
PubChem CID10847476
Molecular FormulaC11H11NO3S
Molecular Weight237.28 g/mol
Exact Mass237.05
IUPAC Name2-(4-oxo-2-phenyl-1,3-thiazolidin-3-yl)acetic acid
SMILESO=C(O)CN1C(=O)CSC1c1ccccc1
InChIInChI=1S/C11H11NO3S/c13-9-7-16-11(12(9)6-10(14)15)8-4-2-1-3-5-8/h1-5,11H,6-7H2,(H,14,15)
InChIKeyRACZCUSQYCSZAE-UHFFFAOYSA-N
XLogP1.35
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds3
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500237.28
LogP ≤ 51.35
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Analyze 2-(4-oxo-2-phenyl-1,3-thiazolidin-3-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(4-oxo-2-phenyl-1,3-thiazolidin-3-yl)acetic acid?
The IUPAC name of 2-(4-oxo-2-phenyl-1,3-thiazolidin-3-yl)acetic acid (CID 10847476) is 2-(4-oxo-2-phenyl-1,3-thiazolidin-3-yl)acetic acid.
What is the SMILES notation for 2-(4-oxo-2-phenyl-1,3-thiazolidin-3-yl)acetic acid?
The canonical SMILES for 2-(4-oxo-2-phenyl-1,3-thiazolidin-3-yl)acetic acid is O=C(O)CN1C(=O)CSC1c1ccccc1.
What is the InChIKey of 2-(4-oxo-2-phenyl-1,3-thiazolidin-3-yl)acetic acid?
The InChIKey is RACZCUSQYCSZAE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11NO3S/c13-9-7-16-11(12(9)6-10(14)15)8-4-2-1-3-5-8/h1-5,11H,6-7H2,(H,14,15).
What are the key properties of 2-(4-oxo-2-phenyl-1,3-thiazolidin-3-yl)acetic acid?
2-(4-oxo-2-phenyl-1,3-thiazolidin-3-yl)acetic acid has a molecular weight of 237.28 g/mol, XLogP of 1.35, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-oxo-2-phenyl-1,3-thiazolidin-3-yl)acetic acid is sourced from PubChem (CID 10847476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).