C12H17NO4 — CID 10847582
tert-butyl N-[(3S,3aR,6aR)-2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-3-yl]carbamate (PubChem CID 10847582) has the molecular formula C12H17NO4 and a molecular weight of 239.27 g/mol. Its IUPAC name is tert-butyl N-[(3S,3aR,6aR)-2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S,3aR,6aR)-2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-3-yl]carbamate |
|---|---|
| PubChem CID | 10847582 |
| Molecular Formula | C12H17NO4 |
| Molecular Weight | 239.27 g/mol |
| Exact Mass | 239.12 |
| IUPAC Name | tert-butyl N-[(3S,3aR,6aR)-2-oxo-3,3a,4,6a-tetrahydrocyclopenta[b]furan-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1C(=O)O[C@@H]2C=CC[C@H]12 |
| InChI | InChI=1S/C12H17NO4/c1-12(2,3)17-11(15)13-9-7-5-4-6-8(7)16-10(9)14/h4,6-9H,5H2,1-3H3,(H,13,15)/t7-,8+,9-/m0/s1 |
| InChIKey | VXPBHSWNSOIAFC-YIZRAAEISA-N |
| XLogP | 1.38 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.27 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|