About 7-methylsulfanyl-2-propan-2-yloxy-1,3-benzothiazole
7-methylsulfanyl-2-propan-2-yloxy-1,3-benzothiazole (PubChem CID 10847606) has the molecular formula C11H13NOS2
and a molecular weight of 239.36 g/mol. Its IUPAC name is 7-methylsulfanyl-2-propan-2-yloxy-1,3-benzothiazole.
Molecular Properties
| Compound Name | 7-methylsulfanyl-2-propan-2-yloxy-1,3-benzothiazole |
| PubChem CID | 10847606 |
| Molecular Formula | C11H13NOS2 |
| Molecular Weight | 239.36 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 7-methylsulfanyl-2-propan-2-yloxy-1,3-benzothiazole |
| SMILES | CSc1cccc2nc(OC(C)C)sc12 |
| InChI | InChI=1S/C11H13NOS2/c1-7(2)13-11-12-8-5-4-6-9(14-3)10(8)15-11/h4-7H,1-3H3 |
| InChIKey | UQNOOKDISASKFV-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 22.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 239.36 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 7-methylsulfanyl-2-propan-2-yloxy-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-methylsulfanyl-2-propan-2-yloxy-1,3-benzothiazole?
The IUPAC name of 7-methylsulfanyl-2-propan-2-yloxy-1,3-benzothiazole (CID 10847606) is 7-methylsulfanyl-2-propan-2-yloxy-1,3-benzothiazole.
What is the SMILES notation for 7-methylsulfanyl-2-propan-2-yloxy-1,3-benzothiazole?
The canonical SMILES for 7-methylsulfanyl-2-propan-2-yloxy-1,3-benzothiazole is CSc1cccc2nc(OC(C)C)sc12.
What is the InChIKey of 7-methylsulfanyl-2-propan-2-yloxy-1,3-benzothiazole?
The InChIKey is UQNOOKDISASKFV-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13NOS2/c1-7(2)13-11-12-8-5-4-6-9(14-3)10(8)15-11/h4-7H,1-3H3.
What are the key properties of 7-methylsulfanyl-2-propan-2-yloxy-1,3-benzothiazole?
7-methylsulfanyl-2-propan-2-yloxy-1,3-benzothiazole has a molecular weight of 239.36 g/mol, XLogP of 3.81, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 7-methylsulfanyl-2-propan-2-yloxy-1,3-benzothiazole is sourced from PubChem (CID 10847606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).