About 3-oxo-5,6-dihydro-2H-benzo[h]cinnoline-4-carboxylic acid
3-oxo-5,6-dihydro-2H-benzo[h]cinnoline-4-carboxylic acid (PubChem CID 10847727) has the molecular formula C13H10N2O3
and a molecular weight of 242.23 g/mol. Its IUPAC name is 3-oxo-5,6-dihydro-2H-benzo[h]cinnoline-4-carboxylic acid.
Molecular Properties
| Compound Name | 3-oxo-5,6-dihydro-2H-benzo[h]cinnoline-4-carboxylic acid |
| PubChem CID | 10847727 |
| Molecular Formula | C13H10N2O3 |
| Molecular Weight | 242.23 g/mol |
| Exact Mass | 242.07 |
| IUPAC Name | 3-oxo-5,6-dihydro-2H-benzo[h]cinnoline-4-carboxylic acid |
| SMILES | O=C(O)c1c2c(n[nH]c1=O)-c1ccccc1CC2 |
| InChI | InChI=1S/C13H10N2O3/c16-12-10(13(17)18)9-6-5-7-3-1-2-4-8(7)11(9)14-15-12/h1-4H,5-6H2,(H,15,16)(H,17,18) |
| InChIKey | PMBCMAWQOIKFGM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 83.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.23 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-oxo-5,6-dihydro-2H-benzo[h]cinnoline-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-oxo-5,6-dihydro-2H-benzo[h]cinnoline-4-carboxylic acid?
The IUPAC name of 3-oxo-5,6-dihydro-2H-benzo[h]cinnoline-4-carboxylic acid (CID 10847727) is 3-oxo-5,6-dihydro-2H-benzo[h]cinnoline-4-carboxylic acid.
What is the SMILES notation for 3-oxo-5,6-dihydro-2H-benzo[h]cinnoline-4-carboxylic acid?
The canonical SMILES for 3-oxo-5,6-dihydro-2H-benzo[h]cinnoline-4-carboxylic acid is O=C(O)c1c2c(n[nH]c1=O)-c1ccccc1CC2.
What is the InChIKey of 3-oxo-5,6-dihydro-2H-benzo[h]cinnoline-4-carboxylic acid?
The InChIKey is PMBCMAWQOIKFGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10N2O3/c16-12-10(13(17)18)9-6-5-7-3-1-2-4-8(7)11(9)14-15-12/h1-4H,5-6H2,(H,15,16)(H,17,18).
What are the key properties of 3-oxo-5,6-dihydro-2H-benzo[h]cinnoline-4-carboxylic acid?
3-oxo-5,6-dihydro-2H-benzo[h]cinnoline-4-carboxylic acid has a molecular weight of 242.23 g/mol, XLogP of 1.23, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-oxo-5,6-dihydro-2H-benzo[h]cinnoline-4-carboxylic acid is sourced from PubChem (CID 10847727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).