C16H22N2 — CID 10847766
2-pentyl-1,3,4,9-tetrahydropyrido[3,4-b]indole (PubChem CID 10847766) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 2-pentyl-1,3,4,9-tetrahydropyrido[3,4-b]indole.
| Compound Name | 2-pentyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
|---|---|
| PubChem CID | 10847766 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 2-pentyl-1,3,4,9-tetrahydropyrido[3,4-b]indole |
| SMILES | CCCCCN1CCc2c([nH]c3ccccc23)C1 |
| InChI | InChI=1S/C16H22N2/c1-2-3-6-10-18-11-9-14-13-7-4-5-8-15(13)17-16(14)12-18/h4-5,7-8,17H,2-3,6,9-12H2,1H3 |
| InChIKey | OMZMLWXQELNEIX-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 19.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|