About (8S,9S)-5-methylidene-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodec-1(12)-ene-4,11-dione
(8S,9S)-5-methylidene-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodec-1(12)-ene-4,11-dione (PubChem CID 10848011) has the molecular formula C15H18O3
and a molecular weight of 246.31 g/mol. Its IUPAC name is (8S,9S)-5-methylidene-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodec-1(12)-ene-4,11-dione.
Molecular Properties
| Compound Name | (8S,9S)-5-methylidene-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodec-1(12)-ene-4,11-dione |
| PubChem CID | 10848011 |
| Molecular Formula | C15H18O3 |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.13 |
| IUPAC Name | (8S,9S)-5-methylidene-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodec-1(12)-ene-4,11-dione |
| SMILES | C=C1CC[C@@H](C(=C)C)[C@@H]2C=C(CCC1=O)C(=O)O2 |
| InChI | InChI=1S/C15H18O3/c1-9(2)12-6-4-10(3)13(16)7-5-11-8-14(12)18-15(11)17/h8,12,14H,1,3-7H2,2H3/t12-,14-/m0/s1 |
| InChIKey | XUDVAHPYULHLEB-JSGCOSHPSA-N |
| XLogP | 2.73 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (8S,9S)-5-methylidene-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodec-1(12)-ene-4,11-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (8S,9S)-5-methylidene-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodec-1(12)-ene-4,11-dione?
The IUPAC name of (8S,9S)-5-methylidene-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodec-1(12)-ene-4,11-dione (CID 10848011) is (8S,9S)-5-methylidene-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodec-1(12)-ene-4,11-dione.
What is the SMILES notation for (8S,9S)-5-methylidene-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodec-1(12)-ene-4,11-dione?
The canonical SMILES for (8S,9S)-5-methylidene-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodec-1(12)-ene-4,11-dione is C=C1CC[C@@H](C(=C)C)[C@@H]2C=C(CCC1=O)C(=O)O2.
What is the InChIKey of (8S,9S)-5-methylidene-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodec-1(12)-ene-4,11-dione?
The InChIKey is XUDVAHPYULHLEB-JSGCOSHPSA-N. The full InChI is InChI=1S/C15H18O3/c1-9(2)12-6-4-10(3)13(16)7-5-11-8-14(12)18-15(11)17/h8,12,14H,1,3-7H2,2H3/t12-,14-/m0/s1.
What are the key properties of (8S,9S)-5-methylidene-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodec-1(12)-ene-4,11-dione?
(8S,9S)-5-methylidene-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodec-1(12)-ene-4,11-dione has a molecular weight of 246.31 g/mol, XLogP of 2.73, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (8S,9S)-5-methylidene-8-prop-1-en-2-yl-10-oxabicyclo[7.2.1]dodec-1(12)-ene-4,11-dione is sourced from PubChem (CID 10848011), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).