About 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-one
3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-one (PubChem CID 10848389) has the molecular formula C9H7F3O3S
and a molecular weight of 252.21 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-one.
Molecular Properties
| Compound Name | 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-one |
| PubChem CID | 10848389 |
| Molecular Formula | C9H7F3O3S |
| Molecular Weight | 252.21 g/mol |
| Exact Mass | 252.01 |
| IUPAC Name | 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-one |
| SMILES | O=C(CS(=O)(=O)c1ccccc1)C(F)(F)F |
| InChI | InChI=1S/C9H7F3O3S/c10-9(11,12)8(13)6-16(14,15)7-4-2-1-3-5-7/h1-5H,6H2 |
| InChIKey | SQHAPBUNTLEHNN-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.21 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-one?
The IUPAC name of 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-one (CID 10848389) is 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-one.
What is the SMILES notation for 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-one?
The canonical SMILES for 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-one is O=C(CS(=O)(=O)c1ccccc1)C(F)(F)F.
What is the InChIKey of 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-one?
The InChIKey is SQHAPBUNTLEHNN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7F3O3S/c10-9(11,12)8(13)6-16(14,15)7-4-2-1-3-5-7/h1-5H,6H2.
What are the key properties of 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-one?
3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-one has a molecular weight of 252.21 g/mol, XLogP of 1.59, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(benzenesulfonyl)-1,1,1-trifluoropropan-2-one is sourced from PubChem (CID 10848389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).