C14H26O2Si — CID 10848573
(1S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxybicyclo[2.2.2]octan-2-one (PubChem CID 10848573) has the molecular formula C14H26O2Si and a molecular weight of 254.45 g/mol. Its IUPAC name is (1S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxybicyclo[2.2.2]octan-2-one.
| Compound Name | (1S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxybicyclo[2.2.2]octan-2-one |
|---|---|
| PubChem CID | 10848573 |
| Molecular Formula | C14H26O2Si |
| Molecular Weight | 254.45 g/mol |
| Exact Mass | 254.17 |
| IUPAC Name | (1S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxybicyclo[2.2.2]octan-2-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@H]1C[C@@H]2CC[C@H]1CC2=O |
| InChI | InChI=1S/C14H26O2Si/c1-14(2,3)17(4,5)16-13-9-10-6-7-11(13)8-12(10)15/h10-11,13H,6-9H2,1-5H3/t10-,11-,13-/m0/s1 |
| InChIKey | FUERARYBIXAMGM-GVXVVHGQSA-N |
| XLogP | 3.77 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.45 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|