C14H24O2S — CID 10848701
tert-butyl (1R,2S)-1,3,4-trimethyl-2-methylsulfanylcyclopent-3-ene-1-carboxylate (PubChem CID 10848701) has the molecular formula C14H24O2S and a molecular weight of 256.41 g/mol. Its IUPAC name is tert-butyl (1R,2S)-1,3,4-trimethyl-2-methylsulfanylcyclopent-3-ene-1-carboxylate.
| Compound Name | tert-butyl (1R,2S)-1,3,4-trimethyl-2-methylsulfanylcyclopent-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 10848701 |
| Molecular Formula | C14H24O2S |
| Molecular Weight | 256.41 g/mol |
| Exact Mass | 256.15 |
| IUPAC Name | tert-butyl (1R,2S)-1,3,4-trimethyl-2-methylsulfanylcyclopent-3-ene-1-carboxylate |
| SMILES | CS[C@H]1C(C)=C(C)C[C@]1(C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C14H24O2S/c1-9-8-14(6,11(17-7)10(9)2)12(15)16-13(3,4)5/h11H,8H2,1-7H3/t11-,14-/m0/s1 |
| InChIKey | OQMATFFQVFYDSF-FZMZJTMJSA-N |
| XLogP | 3.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.41 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|