C7H5BrN2O4 — CID 10848958
2-(bromomethyl)-1,3-dinitrobenzene (PubChem CID 10848958) has the molecular formula C7H5BrN2O4 and a molecular weight of 261.03 g/mol. Its IUPAC name is 2-(bromomethyl)-1,3-dinitrobenzene.
| Compound Name | 2-(bromomethyl)-1,3-dinitrobenzene |
|---|---|
| PubChem CID | 10848958 |
| Molecular Formula | C7H5BrN2O4 |
| Molecular Weight | 261.03 g/mol |
| Exact Mass | 259.94 |
| IUPAC Name | 2-(bromomethyl)-1,3-dinitrobenzene |
| SMILES | O=[N+]([O-])c1cccc([N+](=O)[O-])c1CBr |
| InChI | InChI=1S/C7H5BrN2O4/c8-4-5-6(9(11)12)2-1-3-7(5)10(13)14/h1-3H,4H2 |
| InChIKey | RPOOJGRJKDZPRA-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 86.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.03 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|