About (1S,2R)-N,2-dimethyl-1-phenyl-N-trimethylsilyloxybut-3-en-1-amine
(1S,2R)-N,2-dimethyl-1-phenyl-N-trimethylsilyloxybut-3-en-1-amine (PubChem CID 10849171) has the molecular formula C15H25NOSi
and a molecular weight of 263.46 g/mol. Its IUPAC name is (1S,2R)-N,2-dimethyl-1-phenyl-N-trimethylsilyloxybut-3-en-1-amine.
Molecular Properties
| Compound Name | (1S,2R)-N,2-dimethyl-1-phenyl-N-trimethylsilyloxybut-3-en-1-amine |
| PubChem CID | 10849171 |
| Molecular Formula | C15H25NOSi |
| Molecular Weight | 263.46 g/mol |
| Exact Mass | 263.17 |
| IUPAC Name | (1S,2R)-N,2-dimethyl-1-phenyl-N-trimethylsilyloxybut-3-en-1-amine |
| SMILES | C=C[C@@H](C)[C@@H](c1ccccc1)N(C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H25NOSi/c1-7-13(2)15(14-11-9-8-10-12-14)16(3)17-18(4,5)6/h7-13,15H,1H2,2-6H3/t13-,15+/m1/s1 |
| InChIKey | NBDXMFUNCKXBPS-HIFRSBDPSA-N |
| XLogP | 4.25 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.46 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1S,2R)-N,2-dimethyl-1-phenyl-N-trimethylsilyloxybut-3-en-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1S,2R)-N,2-dimethyl-1-phenyl-N-trimethylsilyloxybut-3-en-1-amine?
The IUPAC name of (1S,2R)-N,2-dimethyl-1-phenyl-N-trimethylsilyloxybut-3-en-1-amine (CID 10849171) is (1S,2R)-N,2-dimethyl-1-phenyl-N-trimethylsilyloxybut-3-en-1-amine.
What is the SMILES notation for (1S,2R)-N,2-dimethyl-1-phenyl-N-trimethylsilyloxybut-3-en-1-amine?
The canonical SMILES for (1S,2R)-N,2-dimethyl-1-phenyl-N-trimethylsilyloxybut-3-en-1-amine is C=C[C@@H](C)[C@@H](c1ccccc1)N(C)O[Si](C)(C)C.
What is the InChIKey of (1S,2R)-N,2-dimethyl-1-phenyl-N-trimethylsilyloxybut-3-en-1-amine?
The InChIKey is NBDXMFUNCKXBPS-HIFRSBDPSA-N. The full InChI is InChI=1S/C15H25NOSi/c1-7-13(2)15(14-11-9-8-10-12-14)16(3)17-18(4,5)6/h7-13,15H,1H2,2-6H3/t13-,15+/m1/s1.
What are the key properties of (1S,2R)-N,2-dimethyl-1-phenyl-N-trimethylsilyloxybut-3-en-1-amine?
(1S,2R)-N,2-dimethyl-1-phenyl-N-trimethylsilyloxybut-3-en-1-amine has a molecular weight of 263.46 g/mol, XLogP of 4.25, 6 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1S,2R)-N,2-dimethyl-1-phenyl-N-trimethylsilyloxybut-3-en-1-amine is sourced from PubChem (CID 10849171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).