About 2-propylpyrazol-3-amine
2-propylpyrazol-3-amine (PubChem CID 1084923) has the molecular formula C6H11N3
and a molecular weight of 125.17 g/mol. Its IUPAC name is 2-propylpyrazol-3-amine.
Molecular Properties
| Compound Name | 2-propylpyrazol-3-amine |
| PubChem CID | 1084923 |
| Molecular Formula | C6H11N3 |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.10 |
| IUPAC Name | 2-propylpyrazol-3-amine |
| SMILES | CCCn1nccc1N |
| InChI | InChI=1S/C6H11N3/c1-2-5-9-6(7)3-4-8-9/h3-4H,2,5,7H2,1H3 |
| InChIKey | OPRZPQAAUXRYDU-UHFFFAOYSA-N |
| XLogP | 0.88 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 0.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-propylpyrazol-3-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylpyrazol-3-amine?
The IUPAC name of 2-propylpyrazol-3-amine (CID 1084923) is 2-propylpyrazol-3-amine.
What is the SMILES notation for 2-propylpyrazol-3-amine?
The canonical SMILES for 2-propylpyrazol-3-amine is CCCn1nccc1N.
What is the InChIKey of 2-propylpyrazol-3-amine?
The InChIKey is OPRZPQAAUXRYDU-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11N3/c1-2-5-9-6(7)3-4-8-9/h3-4H,2,5,7H2,1H3.
What are the key properties of 2-propylpyrazol-3-amine?
2-propylpyrazol-3-amine has a molecular weight of 125.17 g/mol, XLogP of 0.88, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylpyrazol-3-amine is sourced from PubChem (CID 1084923), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).