About methyl (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylate
methyl (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylate (PubChem CID 10849257) has the molecular formula C8H9BrO5
and a molecular weight of 265.06 g/mol. Its IUPAC name is methyl (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylate.
Molecular Properties
| Compound Name | methyl (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylate |
| PubChem CID | 10849257 |
| Molecular Formula | C8H9BrO5 |
| Molecular Weight | 265.06 g/mol |
| Exact Mass | 263.96 |
| IUPAC Name | methyl (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylate |
| SMILES | COC(=O)C1=C(Br)C(=O)[C@@H](O)[C@H](O)C1 |
| InChI | InChI=1S/C8H9BrO5/c1-14-8(13)3-2-4(10)6(11)7(12)5(3)9/h4,6,10-11H,2H2,1H3/t4-,6+/m1/s1 |
| InChIKey | NDIFSTPPXPPKLH-XINAWCOVSA-N |
| XLogP | -0.50 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.06 |
| LogP ≤ 5 | -0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'} |
|---|
Analyze methyl (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylate?
The IUPAC name of methyl (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylate (CID 10849257) is methyl (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylate.
What is the SMILES notation for methyl (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylate?
The canonical SMILES for methyl (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylate is COC(=O)C1=C(Br)C(=O)[C@@H](O)[C@H](O)C1.
What is the InChIKey of methyl (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylate?
The InChIKey is NDIFSTPPXPPKLH-XINAWCOVSA-N. The full InChI is InChI=1S/C8H9BrO5/c1-14-8(13)3-2-4(10)6(11)7(12)5(3)9/h4,6,10-11H,2H2,1H3/t4-,6+/m1/s1.
What are the key properties of methyl (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylate?
methyl (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylate has a molecular weight of 265.06 g/mol, XLogP of -0.50, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (4S,5R)-2-bromo-4,5-dihydroxy-3-oxocyclohexene-1-carboxylate is sourced from PubChem (CID 10849257), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).