C9H9F7O — CID 10849342
1,3,3,4,4,5,5-heptafluoro-2-[(2-methylpropan-2-yl)oxy]cyclopentene (PubChem CID 10849342) has the molecular formula C9H9F7O and a molecular weight of 266.16 g/mol. Its IUPAC name is 1,3,3,4,4,5,5-heptafluoro-2-[(2-methylpropan-2-yl)oxy]cyclopentene.
| Compound Name | 1,3,3,4,4,5,5-heptafluoro-2-[(2-methylpropan-2-yl)oxy]cyclopentene |
|---|---|
| PubChem CID | 10849342 |
| Molecular Formula | C9H9F7O |
| Molecular Weight | 266.16 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | 1,3,3,4,4,5,5-heptafluoro-2-[(2-methylpropan-2-yl)oxy]cyclopentene |
| SMILES | CC(C)(C)OC1=C(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C9H9F7O/c1-6(2,3)17-5-4(10)7(11,12)9(15,16)8(5,13)14/h1-3H3 |
| InChIKey | KRWRDBDQODUQGH-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.16 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|