C13H16O6 — CID 10849475
(2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-phenylmethoxyoxane-2-carbaldehyde (PubChem CID 10849475) has the molecular formula C13H16O6 and a molecular weight of 268.26 g/mol. Its IUPAC name is (2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-phenylmethoxyoxane-2-carbaldehyde.
| Compound Name | (2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-phenylmethoxyoxane-2-carbaldehyde |
|---|---|
| PubChem CID | 10849475 |
| Molecular Formula | C13H16O6 |
| Molecular Weight | 268.26 g/mol |
| Exact Mass | 268.09 |
| IUPAC Name | (2S,3R,4S,5R,6R)-3,4,5-trihydroxy-6-phenylmethoxyoxane-2-carbaldehyde |
| SMILES | O=C[C@H]1O[C@@H](OCc2ccccc2)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C13H16O6/c14-6-9-10(15)11(16)12(17)13(19-9)18-7-8-4-2-1-3-5-8/h1-6,9-13,15-17H,7H2/t9-,10+,11+,12-,13-/m1/s1 |
| InChIKey | BMOZUSQKMVZFGR-KSSYENDESA-N |
| XLogP | -0.79 |
| TPSA | 96.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.26 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|