C14H20O5 — CID 10849484
(1R,4S,7S)-7-acetyl-1,3,3-trimethoxy-5-methylbicyclo[2.2.2]oct-5-en-2-one (PubChem CID 10849484) has the molecular formula C14H20O5 and a molecular weight of 268.31 g/mol. Its IUPAC name is (1R,4S,7S)-7-acetyl-1,3,3-trimethoxy-5-methylbicyclo[2.2.2]oct-5-en-2-one.
| Compound Name | (1R,4S,7S)-7-acetyl-1,3,3-trimethoxy-5-methylbicyclo[2.2.2]oct-5-en-2-one |
|---|---|
| PubChem CID | 10849484 |
| Molecular Formula | C14H20O5 |
| Molecular Weight | 268.31 g/mol |
| Exact Mass | 268.13 |
| IUPAC Name | (1R,4S,7S)-7-acetyl-1,3,3-trimethoxy-5-methylbicyclo[2.2.2]oct-5-en-2-one |
| SMILES | COC1(OC)C(=O)[C@@]2(OC)C=C(C)[C@@H]1C[C@@H]2C(C)=O |
| InChI | InChI=1S/C14H20O5/c1-8-7-13(17-3)11(9(2)15)6-10(8)14(18-4,19-5)12(13)16/h7,10-11H,6H2,1-5H3/t10-,11+,13+/m0/s1 |
| InChIKey | MPJKIJQLEOZXEY-DMDPSCGWSA-N |
| XLogP | 1.11 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.31 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|