C16H30O3 — CID 10849678
1-[(2S,4R,6S)-6-hexyl-2-propan-2-yl-1,3-dioxan-4-yl]propan-1-one (PubChem CID 10849678) has the molecular formula C16H30O3 and a molecular weight of 270.41 g/mol. Its IUPAC name is 1-[(2S,4R,6S)-6-hexyl-2-propan-2-yl-1,3-dioxan-4-yl]propan-1-one.
| Compound Name | 1-[(2S,4R,6S)-6-hexyl-2-propan-2-yl-1,3-dioxan-4-yl]propan-1-one |
|---|---|
| PubChem CID | 10849678 |
| Molecular Formula | C16H30O3 |
| Molecular Weight | 270.41 g/mol |
| Exact Mass | 270.22 |
| IUPAC Name | 1-[(2S,4R,6S)-6-hexyl-2-propan-2-yl-1,3-dioxan-4-yl]propan-1-one |
| SMILES | CCCCCC[C@H]1C[C@H](C(=O)CC)O[C@@H](C(C)C)O1 |
| InChI | InChI=1S/C16H30O3/c1-5-7-8-9-10-13-11-15(14(17)6-2)19-16(18-13)12(3)4/h12-13,15-16H,5-11H2,1-4H3/t13-,15+,16-/m0/s1 |
| InChIKey | JNNHIEICCDWQPE-IMJJTQAJSA-N |
| XLogP | 4.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.41 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|