About (2S,3S)-2-tert-butyl-3-(2-trimethylsilylethoxy)-2,3-dihydropyran-6-one
(2S,3S)-2-tert-butyl-3-(2-trimethylsilylethoxy)-2,3-dihydropyran-6-one (PubChem CID 10849681) has the molecular formula C14H26O3Si
and a molecular weight of 270.44 g/mol. Its IUPAC name is (2S,3S)-2-tert-butyl-3-(2-trimethylsilylethoxy)-2,3-dihydropyran-6-one.
Molecular Properties
| Compound Name | (2S,3S)-2-tert-butyl-3-(2-trimethylsilylethoxy)-2,3-dihydropyran-6-one |
| PubChem CID | 10849681 |
| Molecular Formula | C14H26O3Si |
| Molecular Weight | 270.44 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (2S,3S)-2-tert-butyl-3-(2-trimethylsilylethoxy)-2,3-dihydropyran-6-one |
| SMILES | CC(C)(C)[C@@H]1OC(=O)C=C[C@@H]1OCC[Si](C)(C)C |
| InChI | InChI=1S/C14H26O3Si/c1-14(2,3)13-11(7-8-12(15)17-13)16-9-10-18(4,5)6/h7-8,11,13H,9-10H2,1-6H3/t11-,13+/m0/s1 |
| InChIKey | FGDJRHOGYGWDJK-WCQYABFASA-N |
| XLogP | 3.24 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 270.44 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze (2S,3S)-2-tert-butyl-3-(2-trimethylsilylethoxy)-2,3-dihydropyran-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S,3S)-2-tert-butyl-3-(2-trimethylsilylethoxy)-2,3-dihydropyran-6-one?
The IUPAC name of (2S,3S)-2-tert-butyl-3-(2-trimethylsilylethoxy)-2,3-dihydropyran-6-one (CID 10849681) is (2S,3S)-2-tert-butyl-3-(2-trimethylsilylethoxy)-2,3-dihydropyran-6-one.
What is the SMILES notation for (2S,3S)-2-tert-butyl-3-(2-trimethylsilylethoxy)-2,3-dihydropyran-6-one?
The canonical SMILES for (2S,3S)-2-tert-butyl-3-(2-trimethylsilylethoxy)-2,3-dihydropyran-6-one is CC(C)(C)[C@@H]1OC(=O)C=C[C@@H]1OCC[Si](C)(C)C.
What is the InChIKey of (2S,3S)-2-tert-butyl-3-(2-trimethylsilylethoxy)-2,3-dihydropyran-6-one?
The InChIKey is FGDJRHOGYGWDJK-WCQYABFASA-N. The full InChI is InChI=1S/C14H26O3Si/c1-14(2,3)13-11(7-8-12(15)17-13)16-9-10-18(4,5)6/h7-8,11,13H,9-10H2,1-6H3/t11-,13+/m0/s1.
What are the key properties of (2S,3S)-2-tert-butyl-3-(2-trimethylsilylethoxy)-2,3-dihydropyran-6-one?
(2S,3S)-2-tert-butyl-3-(2-trimethylsilylethoxy)-2,3-dihydropyran-6-one has a molecular weight of 270.44 g/mol, XLogP of 3.24, 4 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2S,3S)-2-tert-butyl-3-(2-trimethylsilylethoxy)-2,3-dihydropyran-6-one is sourced from PubChem (CID 10849681), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).