About 2-ethoxyphenoxathiine 10,10-dioxide
2-ethoxyphenoxathiine 10,10-dioxide (PubChem CID 10850054) has the molecular formula C14H12O4S
and a molecular weight of 276.31 g/mol. Its IUPAC name is 2-ethoxyphenoxathiine 10,10-dioxide.
Molecular Properties
| Compound Name | 2-ethoxyphenoxathiine 10,10-dioxide |
| PubChem CID | 10850054 |
| Molecular Formula | C14H12O4S |
| Molecular Weight | 276.31 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 2-ethoxyphenoxathiine 10,10-dioxide |
| SMILES | CCOc1ccc2c(c1)S(=O)(=O)c1ccccc1O2 |
| InChI | InChI=1S/C14H12O4S/c1-2-17-10-7-8-12-14(9-10)19(15,16)13-6-4-3-5-11(13)18-12/h3-9H,2H2,1H3 |
| InChIKey | QWAUIVMNLJCFFX-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.31 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-ethoxyphenoxathiine 10,10-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyphenoxathiine 10,10-dioxide?
The IUPAC name of 2-ethoxyphenoxathiine 10,10-dioxide (CID 10850054) is 2-ethoxyphenoxathiine 10,10-dioxide.
What is the SMILES notation for 2-ethoxyphenoxathiine 10,10-dioxide?
The canonical SMILES for 2-ethoxyphenoxathiine 10,10-dioxide is CCOc1ccc2c(c1)S(=O)(=O)c1ccccc1O2.
What is the InChIKey of 2-ethoxyphenoxathiine 10,10-dioxide?
The InChIKey is QWAUIVMNLJCFFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O4S/c1-2-17-10-7-8-12-14(9-10)19(15,16)13-6-4-3-5-11(13)18-12/h3-9H,2H2,1H3.
What are the key properties of 2-ethoxyphenoxathiine 10,10-dioxide?
2-ethoxyphenoxathiine 10,10-dioxide has a molecular weight of 276.31 g/mol, XLogP of 3.02, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyphenoxathiine 10,10-dioxide is sourced from PubChem (CID 10850054), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).