C13H24O2S2 — CID 10850100
(2S,3R)-6-(1,3-dithian-2-ylidene)-2-ethylheptane-1,3-diol (PubChem CID 10850100) has the molecular formula C13H24O2S2 and a molecular weight of 276.47 g/mol. Its IUPAC name is (2S,3R)-6-(1,3-dithian-2-ylidene)-2-ethylheptane-1,3-diol.
| Compound Name | (2S,3R)-6-(1,3-dithian-2-ylidene)-2-ethylheptane-1,3-diol |
|---|---|
| PubChem CID | 10850100 |
| Molecular Formula | C13H24O2S2 |
| Molecular Weight | 276.47 g/mol |
| Exact Mass | 276.12 |
| IUPAC Name | (2S,3R)-6-(1,3-dithian-2-ylidene)-2-ethylheptane-1,3-diol |
| SMILES | CC[C@@H](CO)[C@H](O)CCC(C)=C1SCCCS1 |
| InChI | InChI=1S/C13H24O2S2/c1-3-11(9-14)12(15)6-5-10(2)13-16-7-4-8-17-13/h11-12,14-15H,3-9H2,1-2H3/t11-,12+/m0/s1 |
| InChIKey | JXGIVWOYEXJGNH-NWDGAFQWSA-N |
| XLogP | 3.25 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.47 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |