C21H24N2O2 — CID 108502510
N-(4-butylphenyl)-2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoacetamide (PubChem CID 108502510) has the molecular formula C21H24N2O2 and a molecular weight of 336.44 g/mol. Its IUPAC name is N-(4-butylphenyl)-2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoacetamide.
| Compound Name | N-(4-butylphenyl)-2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoacetamide |
|---|---|
| PubChem CID | 108502510 |
| Molecular Formula | C21H24N2O2 |
| Molecular Weight | 336.44 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | N-(4-butylphenyl)-2-(2-methyl-2,3-dihydroindol-1-yl)-2-oxoacetamide |
| SMILES | CCCCc1ccc(NC(=O)C(=O)N2c3ccccc3CC2C)cc1 |
| InChI | InChI=1S/C21H24N2O2/c1-3-4-7-16-10-12-18(13-11-16)22-20(24)21(25)23-15(2)14-17-8-5-6-9-19(17)23/h5-6,8-13,15H,3-4,7,14H2,1-2H3,(H,22,24) |
| InChIKey | PRKXPIRPZVBXIV-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.44 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|