About 7-bromospiro[4H-1,3-benzodioxine-2,4'-piperidine]
7-bromospiro[4H-1,3-benzodioxine-2,4'-piperidine] (PubChem CID 10850583) has the molecular formula C12H14BrNO2
and a molecular weight of 284.15 g/mol. Its IUPAC name is 7-bromospiro[4H-1,3-benzodioxine-2,4'-piperidine].
Molecular Properties
| Compound Name | 7-bromospiro[4H-1,3-benzodioxine-2,4'-piperidine] |
| PubChem CID | 10850583 |
| Molecular Formula | C12H14BrNO2 |
| Molecular Weight | 284.15 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | 7-bromospiro[4H-1,3-benzodioxine-2,4'-piperidine] |
| SMILES | Brc1ccc2c(c1)OC1(CCNCC1)OC2 |
| InChI | InChI=1S/C12H14BrNO2/c13-10-2-1-9-8-15-12(16-11(9)7-10)3-5-14-6-4-12/h1-2,7,14H,3-6,8H2 |
| InChIKey | YRRNFCXUHNWQHE-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.15 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-bromospiro[4H-1,3-benzodioxine-2,4'-piperidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromospiro[4H-1,3-benzodioxine-2,4'-piperidine]?
The IUPAC name of 7-bromospiro[4H-1,3-benzodioxine-2,4'-piperidine] (CID 10850583) is 7-bromospiro[4H-1,3-benzodioxine-2,4'-piperidine].
What is the SMILES notation for 7-bromospiro[4H-1,3-benzodioxine-2,4'-piperidine]?
The canonical SMILES for 7-bromospiro[4H-1,3-benzodioxine-2,4'-piperidine] is Brc1ccc2c(c1)OC1(CCNCC1)OC2.
What is the InChIKey of 7-bromospiro[4H-1,3-benzodioxine-2,4'-piperidine]?
The InChIKey is YRRNFCXUHNWQHE-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrNO2/c13-10-2-1-9-8-15-12(16-11(9)7-10)3-5-14-6-4-12/h1-2,7,14H,3-6,8H2.
What are the key properties of 7-bromospiro[4H-1,3-benzodioxine-2,4'-piperidine]?
7-bromospiro[4H-1,3-benzodioxine-2,4'-piperidine] has a molecular weight of 284.15 g/mol, XLogP of 2.44, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromospiro[4H-1,3-benzodioxine-2,4'-piperidine] is sourced from PubChem (CID 10850583), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).