About ethyl 5-(aminomethyl)-1,2-oxazole-3-carboxylate
ethyl 5-(aminomethyl)-1,2-oxazole-3-carboxylate (PubChem CID 10850588) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is ethyl 5-(aminomethyl)-1,2-oxazole-3-carboxylate.
Molecular Properties
| Compound Name | ethyl 5-(aminomethyl)-1,2-oxazole-3-carboxylate |
| PubChem CID | 10850588 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | ethyl 5-(aminomethyl)-1,2-oxazole-3-carboxylate |
| SMILES | CCOC(=O)c1cc(CN)on1 |
| InChI | InChI=1S/C7H10N2O3/c1-2-11-7(10)6-3-5(4-8)12-9-6/h3H,2,4,8H2,1H3 |
| InChIKey | OJXTUWSIXVDNAL-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 78.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 5-(aminomethyl)-1,2-oxazole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 5-(aminomethyl)-1,2-oxazole-3-carboxylate?
The IUPAC name of ethyl 5-(aminomethyl)-1,2-oxazole-3-carboxylate (CID 10850588) is ethyl 5-(aminomethyl)-1,2-oxazole-3-carboxylate.
What is the SMILES notation for ethyl 5-(aminomethyl)-1,2-oxazole-3-carboxylate?
The canonical SMILES for ethyl 5-(aminomethyl)-1,2-oxazole-3-carboxylate is CCOC(=O)c1cc(CN)on1.
What is the InChIKey of ethyl 5-(aminomethyl)-1,2-oxazole-3-carboxylate?
The InChIKey is OJXTUWSIXVDNAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-2-11-7(10)6-3-5(4-8)12-9-6/h3H,2,4,8H2,1H3.
What are the key properties of ethyl 5-(aminomethyl)-1,2-oxazole-3-carboxylate?
ethyl 5-(aminomethyl)-1,2-oxazole-3-carboxylate has a molecular weight of 170.17 g/mol, XLogP of 0.31, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 5-(aminomethyl)-1,2-oxazole-3-carboxylate is sourced from PubChem (CID 10850588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).