C13H18BrNO — CID 10850590
2-(bromomethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine (PubChem CID 10850590) has the molecular formula C13H18BrNO and a molecular weight of 284.20 g/mol. Its IUPAC name is 2-(bromomethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine.
| Compound Name | 2-(bromomethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine |
|---|---|
| PubChem CID | 10850590 |
| Molecular Formula | C13H18BrNO |
| Molecular Weight | 284.20 g/mol |
| Exact Mass | 283.06 |
| IUPAC Name | 2-(bromomethyl)-2,4,6,7-tetramethyl-3H-1-benzofuran-5-amine |
| SMILES | Cc1c(C)c2c(c(C)c1N)CC(C)(CBr)O2 |
| InChI | InChI=1S/C13H18BrNO/c1-7-8(2)12-10(9(3)11(7)15)5-13(4,6-14)16-12/h5-6,15H2,1-4H3 |
| InChIKey | INMWNYMWBXAGKL-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.20 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|