C24H30N2O4 — CID 108506198
2-(4-benzylpiperidin-1-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-oxoacetamide (PubChem CID 108506198) has the molecular formula C24H30N2O4 and a molecular weight of 410.51 g/mol. Its IUPAC name is 2-(4-benzylpiperidin-1-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-oxoacetamide.
| Compound Name | 2-(4-benzylpiperidin-1-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-oxoacetamide |
|---|---|
| PubChem CID | 108506198 |
| Molecular Formula | C24H30N2O4 |
| Molecular Weight | 410.51 g/mol |
| Exact Mass | 410.22 |
| IUPAC Name | 2-(4-benzylpiperidin-1-yl)-N-[2-(3,4-dimethoxyphenyl)ethyl]-2-oxoacetamide |
| SMILES | COc1ccc(CCNC(=O)C(=O)N2CCC(Cc3ccccc3)CC2)cc1OC |
| InChI | InChI=1S/C24H30N2O4/c1-29-21-9-8-19(17-22(21)30-2)10-13-25-23(27)24(28)26-14-11-20(12-15-26)16-18-6-4-3-5-7-18/h3-9,17,20H,10-16H2,1-2H3,(H,25,27) |
| InChIKey | BINCHZMYOCPSPZ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.51 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|