About piperazin-2-ylmethyl pyrrolidine-1-carboxylate
piperazin-2-ylmethyl pyrrolidine-1-carboxylate (PubChem CID 10850748) has the molecular formula C10H19N3O2
and a molecular weight of 213.28 g/mol. Its IUPAC name is piperazin-2-ylmethyl pyrrolidine-1-carboxylate.
Molecular Properties
| Compound Name | piperazin-2-ylmethyl pyrrolidine-1-carboxylate |
| PubChem CID | 10850748 |
| Molecular Formula | C10H19N3O2 |
| Molecular Weight | 213.28 g/mol |
| Exact Mass | 213.15 |
| IUPAC Name | piperazin-2-ylmethyl pyrrolidine-1-carboxylate |
| SMILES | O=C(OCC1CNCCN1)N1CCCC1 |
| InChI | InChI=1S/C10H19N3O2/c14-10(13-5-1-2-6-13)15-8-9-7-11-3-4-12-9/h9,11-12H,1-8H2 |
| InChIKey | GXHFTSQMFRDVFI-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.28 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze piperazin-2-ylmethyl pyrrolidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of piperazin-2-ylmethyl pyrrolidine-1-carboxylate?
The IUPAC name of piperazin-2-ylmethyl pyrrolidine-1-carboxylate (CID 10850748) is piperazin-2-ylmethyl pyrrolidine-1-carboxylate.
What is the SMILES notation for piperazin-2-ylmethyl pyrrolidine-1-carboxylate?
The canonical SMILES for piperazin-2-ylmethyl pyrrolidine-1-carboxylate is O=C(OCC1CNCCN1)N1CCCC1.
What is the InChIKey of piperazin-2-ylmethyl pyrrolidine-1-carboxylate?
The InChIKey is GXHFTSQMFRDVFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3O2/c14-10(13-5-1-2-6-13)15-8-9-7-11-3-4-12-9/h9,11-12H,1-8H2.
What are the key properties of piperazin-2-ylmethyl pyrrolidine-1-carboxylate?
piperazin-2-ylmethyl pyrrolidine-1-carboxylate has a molecular weight of 213.28 g/mol, XLogP of -0.22, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for piperazin-2-ylmethyl pyrrolidine-1-carboxylate is sourced from PubChem (CID 10850748), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).