C22H19BrN2O2 — CID 108508123
N'-benzhydryl-N-(4-bromo-3-methylphenyl)oxamide (PubChem CID 108508123) has the molecular formula C22H19BrN2O2 and a molecular weight of 423.31 g/mol. Its IUPAC name is N'-benzhydryl-N-(4-bromo-3-methylphenyl)oxamide.
| Compound Name | N'-benzhydryl-N-(4-bromo-3-methylphenyl)oxamide |
|---|---|
| PubChem CID | 108508123 |
| Molecular Formula | C22H19BrN2O2 |
| Molecular Weight | 423.31 g/mol |
| Exact Mass | 422.06 |
| IUPAC Name | N'-benzhydryl-N-(4-bromo-3-methylphenyl)oxamide |
| SMILES | Cc1cc(NC(=O)C(=O)NC(c2ccccc2)c2ccccc2)ccc1Br |
| InChI | InChI=1S/C22H19BrN2O2/c1-15-14-18(12-13-19(15)23)24-21(26)22(27)25-20(16-8-4-2-5-9-16)17-10-6-3-7-11-17/h2-14,20H,1H3,(H,24,26)(H,25,27) |
| InChIKey | YISVUAQRZRWACP-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.31 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|