C13H17ClN2O3 — CID 108508151
N-(3-chloropropyl)-N'-[(4-methoxyphenyl)methyl]oxamide (PubChem CID 108508151) has the molecular formula C13H17ClN2O3 and a molecular weight of 284.74 g/mol. Its IUPAC name is N-(3-chloropropyl)-N'-[(4-methoxyphenyl)methyl]oxamide.
| Compound Name | N-(3-chloropropyl)-N'-[(4-methoxyphenyl)methyl]oxamide |
|---|---|
| PubChem CID | 108508151 |
| Molecular Formula | C13H17ClN2O3 |
| Molecular Weight | 284.74 g/mol |
| Exact Mass | 284.09 |
| IUPAC Name | N-(3-chloropropyl)-N'-[(4-methoxyphenyl)methyl]oxamide |
| SMILES | COc1ccc(CNC(=O)C(=O)NCCCCl)cc1 |
| InChI | InChI=1S/C13H17ClN2O3/c1-19-11-5-3-10(4-6-11)9-16-13(18)12(17)15-8-2-7-14/h3-6H,2,7-9H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | SARNEHSVUOQUDH-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.74 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|