C16H32O4 — CID 10850917
[(3R,4S,5R,6R,7R)-5,7-dihydroxy-4,6,8-trimethylnonan-3-yl] 2-methylpropanoate (PubChem CID 10850917) has the molecular formula C16H32O4 and a molecular weight of 288.43 g/mol. Its IUPAC name is [(3R,4S,5R,6R,7R)-5,7-dihydroxy-4,6,8-trimethylnonan-3-yl] 2-methylpropanoate.
| Compound Name | [(3R,4S,5R,6R,7R)-5,7-dihydroxy-4,6,8-trimethylnonan-3-yl] 2-methylpropanoate |
|---|---|
| PubChem CID | 10850917 |
| Molecular Formula | C16H32O4 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.23 |
| IUPAC Name | [(3R,4S,5R,6R,7R)-5,7-dihydroxy-4,6,8-trimethylnonan-3-yl] 2-methylpropanoate |
| SMILES | CC[C@@H](OC(=O)C(C)C)[C@@H](C)[C@H](O)[C@H](C)[C@H](O)C(C)C |
| InChI | InChI=1S/C16H32O4/c1-8-13(20-16(19)10(4)5)11(6)15(18)12(7)14(17)9(2)3/h9-15,17-18H,8H2,1-7H3/t11-,12-,13-,14-,15+/m1/s1 |
| InChIKey | GWBSINVYUWUOQY-RYPNDVFKSA-N |
| XLogP | 2.61 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |