C9H15N3O4S — CID 108509939
N-(4,5-dihydro-1,3-thiazol-2-yl)-N',N'-bis(2-hydroxyethyl)oxamide (PubChem CID 108509939) has the molecular formula C9H15N3O4S and a molecular weight of 261.30 g/mol. Its IUPAC name is N-(4,5-dihydro-1,3-thiazol-2-yl)-N',N'-bis(2-hydroxyethyl)oxamide.
| Compound Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-N',N'-bis(2-hydroxyethyl)oxamide |
|---|---|
| PubChem CID | 108509939 |
| Molecular Formula | C9H15N3O4S |
| Molecular Weight | 261.30 g/mol |
| Exact Mass | 261.08 |
| IUPAC Name | N-(4,5-dihydro-1,3-thiazol-2-yl)-N',N'-bis(2-hydroxyethyl)oxamide |
| SMILES | O=C(NC1=NCCS1)C(=O)N(CCO)CCO |
| InChI | InChI=1S/C9H15N3O4S/c13-4-2-12(3-5-14)8(16)7(15)11-9-10-1-6-17-9/h13-14H,1-6H2,(H,10,11,15) |
| InChIKey | OLFAAWUJKBHNCU-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 102.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.30 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|