C21H25N — CID 10851141
(1S,5R)-1-methyl-2,4-diphenyl-3-azabicyclo[3.3.1]nonane (PubChem CID 10851141) has the molecular formula C21H25N and a molecular weight of 291.44 g/mol. Its IUPAC name is (1S,5R)-1-methyl-2,4-diphenyl-3-azabicyclo[3.3.1]nonane.
| Compound Name | (1S,5R)-1-methyl-2,4-diphenyl-3-azabicyclo[3.3.1]nonane |
|---|---|
| PubChem CID | 10851141 |
| Molecular Formula | C21H25N |
| Molecular Weight | 291.44 g/mol |
| Exact Mass | 291.20 |
| IUPAC Name | (1S,5R)-1-methyl-2,4-diphenyl-3-azabicyclo[3.3.1]nonane |
| SMILES | C[C@]12CCC[C@H](C1)C(c1ccccc1)NC2c1ccccc1 |
| InChI | InChI=1S/C21H25N/c1-21-14-8-13-18(15-21)19(16-9-4-2-5-10-16)22-20(21)17-11-6-3-7-12-17/h2-7,9-12,18-20,22H,8,13-15H2,1H3/t18-,19?,20?,21+/m1/s1 |
| InChIKey | DENJKFOHTUMCNP-UEKLYDJUSA-N |
| XLogP | 5.27 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.44 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |