C12H10ClN5S — CID 10851152
2-(4-chlorophenyl)-5,6-dimethyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine-7-thione (PubChem CID 10851152) has the molecular formula C12H10ClN5S and a molecular weight of 291.77 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5,6-dimethyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine-7-thione.
| Compound Name | 2-(4-chlorophenyl)-5,6-dimethyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine-7-thione |
|---|---|
| PubChem CID | 10851152 |
| Molecular Formula | C12H10ClN5S |
| Molecular Weight | 291.77 g/mol |
| Exact Mass | 291.03 |
| IUPAC Name | 2-(4-chlorophenyl)-5,6-dimethyl-[1,2,4]triazolo[1,5-a][1,3,5]triazine-7-thione |
| SMILES | Cc1nc2nc(-c3ccc(Cl)cc3)nn2c(=S)n1C |
| InChI | InChI=1S/C12H10ClN5S/c1-7-14-11-15-10(8-3-5-9(13)6-4-8)16-18(11)12(19)17(7)2/h3-6H,1-2H3 |
| InChIKey | LIPYMRRAJNBVRI-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 48.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.77 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|