C18H16ClF3N2O2 — CID 108512311
N-[4-chloro-2-(trifluoromethyl)phenyl]-N'-(2,4,6-trimethylphenyl)oxamide (PubChem CID 108512311) has the molecular formula C18H16ClF3N2O2 and a molecular weight of 384.79 g/mol. Its IUPAC name is N-[4-chloro-2-(trifluoromethyl)phenyl]-N'-(2,4,6-trimethylphenyl)oxamide.
| Compound Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-N'-(2,4,6-trimethylphenyl)oxamide |
|---|---|
| PubChem CID | 108512311 |
| Molecular Formula | C18H16ClF3N2O2 |
| Molecular Weight | 384.79 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | N-[4-chloro-2-(trifluoromethyl)phenyl]-N'-(2,4,6-trimethylphenyl)oxamide |
| SMILES | Cc1cc(C)c(NC(=O)C(=O)Nc2ccc(Cl)cc2C(F)(F)F)c(C)c1 |
| InChI | InChI=1S/C18H16ClF3N2O2/c1-9-6-10(2)15(11(3)7-9)24-17(26)16(25)23-14-5-4-12(19)8-13(14)18(20,21)22/h4-8H,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | HFCASPHJNWKRKZ-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.79 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|