C19H22N2O2 — CID 108512317
N-(2,6-dimethylphenyl)-N'-(2,4,6-trimethylphenyl)oxamide (PubChem CID 108512317) has the molecular formula C19H22N2O2 and a molecular weight of 310.40 g/mol. Its IUPAC name is N-(2,6-dimethylphenyl)-N'-(2,4,6-trimethylphenyl)oxamide.
| Compound Name | N-(2,6-dimethylphenyl)-N'-(2,4,6-trimethylphenyl)oxamide |
|---|---|
| PubChem CID | 108512317 |
| Molecular Formula | C19H22N2O2 |
| Molecular Weight | 310.40 g/mol |
| Exact Mass | 310.17 |
| IUPAC Name | N-(2,6-dimethylphenyl)-N'-(2,4,6-trimethylphenyl)oxamide |
| SMILES | Cc1cc(C)c(NC(=O)C(=O)Nc2c(C)cccc2C)c(C)c1 |
| InChI | InChI=1S/C19H22N2O2/c1-11-9-14(4)17(15(5)10-11)21-19(23)18(22)20-16-12(2)7-6-8-13(16)3/h6-10H,1-5H3,(H,20,22)(H,21,23) |
| InChIKey | DZKSYVVUPVGPBF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.40 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|